C20H16Br2F2O4 — CID 162066821
7-bromo-5-fluoro-2,3-dihydronaphthalene-1,4-dione;7-bromo-5-fluoro-1,2,3,4-tetrahydronaphthalene-1,4-diol (PubChem CID 162066821) has the molecular formula C20H16Br2F2O4 and a molecular weight of 518.15 g/mol. Its IUPAC name is 7-bromo-5-fluoro-2,3-dihydronaphthalene-1,4-dione;7-bromo-5-fluoro-1,2,3,4-tetrahydronaphthalene-1,4-diol.
| Compound Name | 7-bromo-5-fluoro-2,3-dihydronaphthalene-1,4-dione;7-bromo-5-fluoro-1,2,3,4-tetrahydronaphthalene-1,4-diol |
|---|---|
| PubChem CID | 162066821 |
| Molecular Formula | C20H16Br2F2O4 |
| Molecular Weight | 518.15 g/mol |
| Exact Mass | 515.94 |
| IUPAC Name | 7-bromo-5-fluoro-2,3-dihydronaphthalene-1,4-dione;7-bromo-5-fluoro-1,2,3,4-tetrahydronaphthalene-1,4-diol |
| SMILES | O=C1CCC(=O)c2c(F)cc(Br)cc21.OC1CCC(O)c2c(F)cc(Br)cc21 |
| InChI | InChI=1S/C10H10BrFO2.C10H6BrFO2/c2*11-5-3-6-8(13)1-2-9(14)10(6)7(12)4-5/h3-4,8-9,13-14H,1-2H2;3-4H,1-2H2 |
| InChIKey | ZAOJDVFOQCHEHI-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.15 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'keto_keto_gamma(5)', 'substructure': 'N/A'} |
|---|