C10H5BrF4O — CID 58995694
7-bromo-3,4,4,5-tetrafluoro-2,3-dihydronaphthalen-1-one (PubChem CID 58995694) has the molecular formula C10H5BrF4O and a molecular weight of 297.05 g/mol. Its IUPAC name is 7-bromo-3,4,4,5-tetrafluoro-2,3-dihydronaphthalen-1-one.
| Compound Name | 7-bromo-3,4,4,5-tetrafluoro-2,3-dihydronaphthalen-1-one |
|---|---|
| PubChem CID | 58995694 |
| Molecular Formula | C10H5BrF4O |
| Molecular Weight | 297.05 g/mol |
| Exact Mass | 295.95 |
| IUPAC Name | 7-bromo-3,4,4,5-tetrafluoro-2,3-dihydronaphthalen-1-one |
| SMILES | O=C1CC(F)C(F)(F)c2c(F)cc(Br)cc21 |
| InChI | InChI=1S/C10H5BrF4O/c11-4-1-5-7(16)3-8(13)10(14,15)9(5)6(12)2-4/h1-2,8H,3H2 |
| InChIKey | FMZPCCDKAZEUHK-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.05 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |