C9H8BrF2NO — CID 130700324
2-[(2S)-azetidin-2-yl]-3-bromo-5,6-difluorophenol (PubChem CID 130700324) has the molecular formula C9H8BrF2NO and a molecular weight of 264.07 g/mol. Its IUPAC name is 2-[(2S)-azetidin-2-yl]-3-bromo-5,6-difluorophenol.
| Compound Name | 2-[(2S)-azetidin-2-yl]-3-bromo-5,6-difluorophenol |
|---|---|
| PubChem CID | 130700324 |
| Molecular Formula | C9H8BrF2NO |
| Molecular Weight | 264.07 g/mol |
| Exact Mass | 262.98 |
| IUPAC Name | 2-[(2S)-azetidin-2-yl]-3-bromo-5,6-difluorophenol |
| SMILES | Oc1c(F)c(F)cc(Br)c1[C@@H]1CCN1 |
| InChI | InChI=1S/C9H8BrF2NO/c10-4-3-5(11)8(12)9(14)7(4)6-1-2-13-6/h3,6,13-14H,1-2H2/t6-/m0/s1 |
| InChIKey | QYTGURDGQYQAIT-LURJTMIESA-N |
| XLogP | 2.47 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.07 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|