C9H9Br2FN2 — CID 131190603
2-[(2S)-azetidin-2-yl]-4,6-dibromo-3-fluoroaniline (PubChem CID 131190603) has the molecular formula C9H9Br2FN2 and a molecular weight of 323.99 g/mol. Its IUPAC name is 2-[(2S)-azetidin-2-yl]-4,6-dibromo-3-fluoroaniline.
| Compound Name | 2-[(2S)-azetidin-2-yl]-4,6-dibromo-3-fluoroaniline |
|---|---|
| PubChem CID | 131190603 |
| Molecular Formula | C9H9Br2FN2 |
| Molecular Weight | 323.99 g/mol |
| Exact Mass | 321.91 |
| IUPAC Name | 2-[(2S)-azetidin-2-yl]-4,6-dibromo-3-fluoroaniline |
| SMILES | Nc1c(Br)cc(Br)c(F)c1[C@@H]1CCN1 |
| InChI | InChI=1S/C9H9Br2FN2/c10-4-3-5(11)9(13)7(8(4)12)6-1-2-14-6/h3,6,14H,1-2,13H2/t6-/m0/s1 |
| InChIKey | JVULUOKKAAQCRQ-LURJTMIESA-N |
| XLogP | 2.97 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.99 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|