C9H8F2IN — CID 130663816
(2S)-2-(2,6-difluoro-4-iodophenyl)azetidine (PubChem CID 130663816) has the molecular formula C9H8F2IN and a molecular weight of 295.07 g/mol. Its IUPAC name is (2S)-2-(2,6-difluoro-4-iodophenyl)azetidine.
| Compound Name | (2S)-2-(2,6-difluoro-4-iodophenyl)azetidine |
|---|---|
| PubChem CID | 130663816 |
| Molecular Formula | C9H8F2IN |
| Molecular Weight | 295.07 g/mol |
| Exact Mass | 294.97 |
| IUPAC Name | (2S)-2-(2,6-difluoro-4-iodophenyl)azetidine |
| SMILES | Fc1cc(I)cc(F)c1[C@@H]1CCN1 |
| InChI | InChI=1S/C9H8F2IN/c10-6-3-5(12)4-7(11)9(6)8-1-2-13-8/h3-4,8,13H,1-2H2/t8-/m0/s1 |
| InChIKey | YLAMKRSRNUSSHZ-QMMMGPOBSA-N |
| XLogP | 2.60 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.07 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|