C18H19NO2 — CID 115418161
N-(4-methyl-1,2,3,4-tetrahydronaphthalen-1-yl)-1,3-benzodioxol-5-amine (PubChem CID 115418161) has the molecular formula C18H19NO2 and a molecular weight of 281.36 g/mol. Its IUPAC name is N-(4-methyl-1,2,3,4-tetrahydronaphthalen-1-yl)-1,3-benzodioxol-5-amine.
| Compound Name | N-(4-methyl-1,2,3,4-tetrahydronaphthalen-1-yl)-1,3-benzodioxol-5-amine |
|---|---|
| PubChem CID | 115418161 |
| Molecular Formula | C18H19NO2 |
| Molecular Weight | 281.36 g/mol |
| Exact Mass | 281.14 |
| IUPAC Name | N-(4-methyl-1,2,3,4-tetrahydronaphthalen-1-yl)-1,3-benzodioxol-5-amine |
| SMILES | CC1CCC(Nc2ccc3c(c2)OCO3)c2ccccc21 |
| InChI | InChI=1S/C18H19NO2/c1-12-6-8-16(15-5-3-2-4-14(12)15)19-13-7-9-17-18(10-13)21-11-20-17/h2-5,7,9-10,12,16,19H,6,8,11H2,1H3 |
| InChIKey | LKMFOEPOPPXXSR-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.36 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|