C21H28Cl2N2O2 — CID 142665666
4-N-(1,3-benzodioxol-5-yl)-1-N,1-N-dimethyl-1-phenylcyclohexane-1,4-diamine;dihydrochloride (PubChem CID 142665666) has the molecular formula C21H28Cl2N2O2 and a molecular weight of 411.37 g/mol. Its IUPAC name is 4-N-(1,3-benzodioxol-5-yl)-1-N,1-N-dimethyl-1-phenylcyclohexane-1,4-diamine;dihydrochloride.
| Compound Name | 4-N-(1,3-benzodioxol-5-yl)-1-N,1-N-dimethyl-1-phenylcyclohexane-1,4-diamine;dihydrochloride |
|---|---|
| PubChem CID | 142665666 |
| Molecular Formula | C21H28Cl2N2O2 |
| Molecular Weight | 411.37 g/mol |
| Exact Mass | 410.15 |
| IUPAC Name | 4-N-(1,3-benzodioxol-5-yl)-1-N,1-N-dimethyl-1-phenylcyclohexane-1,4-diamine;dihydrochloride |
| SMILES | CN(C)C1(c2ccccc2)CCC(Nc2ccc3c(c2)OCO3)CC1.Cl.Cl |
| InChI | InChI=1S/C21H26N2O2.2ClH/c1-23(2)21(16-6-4-3-5-7-16)12-10-17(11-13-21)22-18-8-9-19-20(14-18)25-15-24-19;;/h3-9,14,17,22H,10-13,15H2,1-2H3;2*1H |
| InChIKey | XJMBDTXYQQRMMS-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.37 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|