About 3-(2-hydroxy-1-pyridin-2-yl-2,2-dipyridin-3-ylethyl)-1,3-oxazolidin-2-one
3-(2-hydroxy-1-pyridin-2-yl-2,2-dipyridin-3-ylethyl)-1,3-oxazolidin-2-one (PubChem CID 11545041) has the molecular formula C20H18N4O3
and a molecular weight of 362.39 g/mol. Its IUPAC name is 3-(2-hydroxy-1-pyridin-2-yl-2,2-dipyridin-3-ylethyl)-1,3-oxazolidin-2-one.
Molecular Properties
| Compound Name | 3-(2-hydroxy-1-pyridin-2-yl-2,2-dipyridin-3-ylethyl)-1,3-oxazolidin-2-one |
| PubChem CID | 11545041 |
| Molecular Formula | C20H18N4O3 |
| Molecular Weight | 362.39 g/mol |
| Exact Mass | 362.14 |
| IUPAC Name | 3-(2-hydroxy-1-pyridin-2-yl-2,2-dipyridin-3-ylethyl)-1,3-oxazolidin-2-one |
| SMILES | O=C1OCCN1C(c1ccccn1)C(O)(c1cccnc1)c1cccnc1 |
| InChI | InChI=1S/C20H18N4O3/c25-19-24(11-12-27-19)18(17-7-1-2-10-23-17)20(26,15-5-3-8-21-13-15)16-6-4-9-22-14-16/h1-10,13-14,18,26H,11-12H2 |
| InChIKey | OBYLGEFEMPEQRI-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 88.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 362.39 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-(2-hydroxy-1-pyridin-2-yl-2,2-dipyridin-3-ylethyl)-1,3-oxazolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2-hydroxy-1-pyridin-2-yl-2,2-dipyridin-3-ylethyl)-1,3-oxazolidin-2-one?
The IUPAC name of 3-(2-hydroxy-1-pyridin-2-yl-2,2-dipyridin-3-ylethyl)-1,3-oxazolidin-2-one (CID 11545041) is 3-(2-hydroxy-1-pyridin-2-yl-2,2-dipyridin-3-ylethyl)-1,3-oxazolidin-2-one.
What is the SMILES notation for 3-(2-hydroxy-1-pyridin-2-yl-2,2-dipyridin-3-ylethyl)-1,3-oxazolidin-2-one?
The canonical SMILES for 3-(2-hydroxy-1-pyridin-2-yl-2,2-dipyridin-3-ylethyl)-1,3-oxazolidin-2-one is O=C1OCCN1C(c1ccccn1)C(O)(c1cccnc1)c1cccnc1.
What is the InChIKey of 3-(2-hydroxy-1-pyridin-2-yl-2,2-dipyridin-3-ylethyl)-1,3-oxazolidin-2-one?
The InChIKey is OBYLGEFEMPEQRI-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H18N4O3/c25-19-24(11-12-27-19)18(17-7-1-2-10-23-17)20(26,15-5-3-8-21-13-15)16-6-4-9-22-14-16/h1-10,13-14,18,26H,11-12H2.
What are the key properties of 3-(2-hydroxy-1-pyridin-2-yl-2,2-dipyridin-3-ylethyl)-1,3-oxazolidin-2-one?
3-(2-hydroxy-1-pyridin-2-yl-2,2-dipyridin-3-ylethyl)-1,3-oxazolidin-2-one has a molecular weight of 362.39 g/mol, XLogP of 2.30, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2-hydroxy-1-pyridin-2-yl-2,2-dipyridin-3-ylethyl)-1,3-oxazolidin-2-one is sourced from PubChem (CID 11545041), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).