C20H18N4O2 — CID 66962388
3-(1-pyridin-2-yl-2,2-dipyridin-3-ylethyl)-1,3-oxazolidin-2-one (PubChem CID 66962388) has the molecular formula C20H18N4O2 and a molecular weight of 346.39 g/mol. Its IUPAC name is 3-(1-pyridin-2-yl-2,2-dipyridin-3-ylethyl)-1,3-oxazolidin-2-one.
| Compound Name | 3-(1-pyridin-2-yl-2,2-dipyridin-3-ylethyl)-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 66962388 |
| Molecular Formula | C20H18N4O2 |
| Molecular Weight | 346.39 g/mol |
| Exact Mass | 346.14 |
| IUPAC Name | 3-(1-pyridin-2-yl-2,2-dipyridin-3-ylethyl)-1,3-oxazolidin-2-one |
| SMILES | O=C1OCCN1C(c1ccccn1)C(c1cccnc1)c1cccnc1 |
| InChI | InChI=1S/C20H18N4O2/c25-20-24(11-12-26-20)19(17-7-1-2-10-23-17)18(15-5-3-8-21-13-15)16-6-4-9-22-14-16/h1-10,13-14,18-19H,11-12H2 |
| InChIKey | AUELUODFEHEWJK-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 68.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.39 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |