About (6-cyclohexyloxy-1,3-dioxobenzo[de]isoquinolin-2-yl)methyl prop-2-enoate
(6-cyclohexyloxy-1,3-dioxobenzo[de]isoquinolin-2-yl)methyl prop-2-enoate (PubChem CID 11545357) has the molecular formula C22H21NO5
and a molecular weight of 379.41 g/mol. Its IUPAC name is (6-cyclohexyloxy-1,3-dioxobenzo[de]isoquinolin-2-yl)methyl prop-2-enoate.
Molecular Properties
| Compound Name | (6-cyclohexyloxy-1,3-dioxobenzo[de]isoquinolin-2-yl)methyl prop-2-enoate |
| PubChem CID | 11545357 |
| Molecular Formula | C22H21NO5 |
| Molecular Weight | 379.41 g/mol |
| Exact Mass | 379.14 |
| IUPAC Name | (6-cyclohexyloxy-1,3-dioxobenzo[de]isoquinolin-2-yl)methyl prop-2-enoate |
| SMILES | C=CC(=O)OCN1C(=O)c2cccc3c(OC4CCCCC4)ccc(c23)C1=O |
| InChI | InChI=1S/C22H21NO5/c1-2-19(24)27-13-23-21(25)16-10-6-9-15-18(28-14-7-4-3-5-8-14)12-11-17(20(15)16)22(23)26/h2,6,9-12,14H,1,3-5,7-8,13H2 |
| InChIKey | UCLSSHKPNQJOAM-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 379.41 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze (6-cyclohexyloxy-1,3-dioxobenzo[de]isoquinolin-2-yl)methyl prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6-cyclohexyloxy-1,3-dioxobenzo[de]isoquinolin-2-yl)methyl prop-2-enoate?
The IUPAC name of (6-cyclohexyloxy-1,3-dioxobenzo[de]isoquinolin-2-yl)methyl prop-2-enoate (CID 11545357) is (6-cyclohexyloxy-1,3-dioxobenzo[de]isoquinolin-2-yl)methyl prop-2-enoate.
What is the SMILES notation for (6-cyclohexyloxy-1,3-dioxobenzo[de]isoquinolin-2-yl)methyl prop-2-enoate?
The canonical SMILES for (6-cyclohexyloxy-1,3-dioxobenzo[de]isoquinolin-2-yl)methyl prop-2-enoate is C=CC(=O)OCN1C(=O)c2cccc3c(OC4CCCCC4)ccc(c23)C1=O.
What is the InChIKey of (6-cyclohexyloxy-1,3-dioxobenzo[de]isoquinolin-2-yl)methyl prop-2-enoate?
The InChIKey is UCLSSHKPNQJOAM-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H21NO5/c1-2-19(24)27-13-23-21(25)16-10-6-9-15-18(28-14-7-4-3-5-8-14)12-11-17(20(15)16)22(23)26/h2,6,9-12,14H,1,3-5,7-8,13H2.
What are the key properties of (6-cyclohexyloxy-1,3-dioxobenzo[de]isoquinolin-2-yl)methyl prop-2-enoate?
(6-cyclohexyloxy-1,3-dioxobenzo[de]isoquinolin-2-yl)methyl prop-2-enoate has a molecular weight of 379.41 g/mol, XLogP of 3.83, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (6-cyclohexyloxy-1,3-dioxobenzo[de]isoquinolin-2-yl)methyl prop-2-enoate is sourced from PubChem (CID 11545357), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).