About 2-[cyclohexyl-(2-hexyl-1,3-dioxobenzo[de]isoquinolin-6-yl)amino]ethyl 2-methylprop-2-enoate
2-[cyclohexyl-(2-hexyl-1,3-dioxobenzo[de]isoquinolin-6-yl)amino]ethyl 2-methylprop-2-enoate (PubChem CID 58942707) has the molecular formula C30H38N2O4
and a molecular weight of 490.64 g/mol. Its IUPAC name is 2-[cyclohexyl-(2-hexyl-1,3-dioxobenzo[de]isoquinolin-6-yl)amino]ethyl 2-methylprop-2-enoate.
Molecular Properties
| Compound Name | 2-[cyclohexyl-(2-hexyl-1,3-dioxobenzo[de]isoquinolin-6-yl)amino]ethyl 2-methylprop-2-enoate |
| PubChem CID | 58942707 |
| Molecular Formula | C30H38N2O4 |
| Molecular Weight | 490.64 g/mol |
| Exact Mass | 490.28 |
| IUPAC Name | 2-[cyclohexyl-(2-hexyl-1,3-dioxobenzo[de]isoquinolin-6-yl)amino]ethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCN(c1ccc2c3c(cccc13)C(=O)N(CCCCCC)C2=O)C1CCCCC1 |
| InChI | InChI=1S/C30H38N2O4/c1-4-5-6-10-18-32-28(33)24-15-11-14-23-26(17-16-25(27(23)24)29(32)34)31(22-12-8-7-9-13-22)19-20-36-30(35)21(2)3/h11,14-17,22H,2,4-10,12-13,18-20H2,1,3H3 |
| InChIKey | METUECRWJOUMSN-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 490.64 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 2-[cyclohexyl-(2-hexyl-1,3-dioxobenzo[de]isoquinolin-6-yl)amino]ethyl 2-methylprop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[cyclohexyl-(2-hexyl-1,3-dioxobenzo[de]isoquinolin-6-yl)amino]ethyl 2-methylprop-2-enoate?
The IUPAC name of 2-[cyclohexyl-(2-hexyl-1,3-dioxobenzo[de]isoquinolin-6-yl)amino]ethyl 2-methylprop-2-enoate (CID 58942707) is 2-[cyclohexyl-(2-hexyl-1,3-dioxobenzo[de]isoquinolin-6-yl)amino]ethyl 2-methylprop-2-enoate.
What is the SMILES notation for 2-[cyclohexyl-(2-hexyl-1,3-dioxobenzo[de]isoquinolin-6-yl)amino]ethyl 2-methylprop-2-enoate?
The canonical SMILES for 2-[cyclohexyl-(2-hexyl-1,3-dioxobenzo[de]isoquinolin-6-yl)amino]ethyl 2-methylprop-2-enoate is C=C(C)C(=O)OCCN(c1ccc2c3c(cccc13)C(=O)N(CCCCCC)C2=O)C1CCCCC1.
What is the InChIKey of 2-[cyclohexyl-(2-hexyl-1,3-dioxobenzo[de]isoquinolin-6-yl)amino]ethyl 2-methylprop-2-enoate?
The InChIKey is METUECRWJOUMSN-UHFFFAOYSA-N. The full InChI is InChI=1S/C30H38N2O4/c1-4-5-6-10-18-32-28(33)24-15-11-14-23-26(17-16-25(27(23)24)29(32)34)31(22-12-8-7-9-13-22)19-20-36-30(35)21(2)3/h11,14-17,22H,2,4-10,12-13,18-20H2,1,3H3.
What are the key properties of 2-[cyclohexyl-(2-hexyl-1,3-dioxobenzo[de]isoquinolin-6-yl)amino]ethyl 2-methylprop-2-enoate?
2-[cyclohexyl-(2-hexyl-1,3-dioxobenzo[de]isoquinolin-6-yl)amino]ethyl 2-methylprop-2-enoate has a molecular weight of 490.64 g/mol, XLogP of 6.27, 11 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[cyclohexyl-(2-hexyl-1,3-dioxobenzo[de]isoquinolin-6-yl)amino]ethyl 2-methylprop-2-enoate is sourced from PubChem (CID 58942707), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).