C27H29NO5 — CID 143118750
5-(2-cyclohept-4-en-1-yl-1,3-dioxobenzo[de]isoquinolin-6-yl)oxypentyl prop-2-enoate (PubChem CID 143118750) has the molecular formula C27H29NO5 and a molecular weight of 447.53 g/mol. Its IUPAC name is 5-(2-cyclohept-4-en-1-yl-1,3-dioxobenzo[de]isoquinolin-6-yl)oxypentyl prop-2-enoate.
| Compound Name | 5-(2-cyclohept-4-en-1-yl-1,3-dioxobenzo[de]isoquinolin-6-yl)oxypentyl prop-2-enoate |
|---|---|
| PubChem CID | 143118750 |
| Molecular Formula | C27H29NO5 |
| Molecular Weight | 447.53 g/mol |
| Exact Mass | 447.20 |
| IUPAC Name | 5-(2-cyclohept-4-en-1-yl-1,3-dioxobenzo[de]isoquinolin-6-yl)oxypentyl prop-2-enoate |
| SMILES | C=CC(=O)OCCCCCOc1ccc2c3c(cccc13)C(=O)N(C1CCC=CCC1)C2=O |
| InChI | InChI=1S/C27H29NO5/c1-2-24(29)33-18-9-5-8-17-32-23-16-15-22-25-20(23)13-10-14-21(25)26(30)28(27(22)31)19-11-6-3-4-7-12-19/h2-4,10,13-16,19H,1,5-9,11-12,17-18H2 |
| InChIKey | DZDOAQYMPZJDQW-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.53 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|