C28H28O5 — CID 139987175
[2-phenyl-6-(6-prop-2-enoyloxyhexoxy)phenyl] benzoate (PubChem CID 139987175) has the molecular formula C28H28O5 and a molecular weight of 444.53 g/mol. Its IUPAC name is [2-phenyl-6-(6-prop-2-enoyloxyhexoxy)phenyl] benzoate.
| Compound Name | [2-phenyl-6-(6-prop-2-enoyloxyhexoxy)phenyl] benzoate |
|---|---|
| PubChem CID | 139987175 |
| Molecular Formula | C28H28O5 |
| Molecular Weight | 444.53 g/mol |
| Exact Mass | 444.19 |
| IUPAC Name | [2-phenyl-6-(6-prop-2-enoyloxyhexoxy)phenyl] benzoate |
| SMILES | C=CC(=O)OCCCCCCOc1cccc(-c2ccccc2)c1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C28H28O5/c1-2-26(29)32-21-12-4-3-11-20-31-25-19-13-18-24(22-14-7-5-8-15-22)27(25)33-28(30)23-16-9-6-10-17-23/h2,5-10,13-19H,1,3-4,11-12,20-21H2 |
| InChIKey | OBAHZIVXBURAFP-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.53 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|