C32H27NO5 — CID 143118762
3-[2-(9a-methyl-4a,9-dihydrofluoren-9-yl)-1,3-dioxobenzo[de]isoquinolin-6-yl]oxypropyl prop-2-enoate (PubChem CID 143118762) has the molecular formula C32H27NO5 and a molecular weight of 505.57 g/mol. Its IUPAC name is 3-[2-(9a-methyl-4a,9-dihydrofluoren-9-yl)-1,3-dioxobenzo[de]isoquinolin-6-yl]oxypropyl prop-2-enoate.
| Compound Name | 3-[2-(9a-methyl-4a,9-dihydrofluoren-9-yl)-1,3-dioxobenzo[de]isoquinolin-6-yl]oxypropyl prop-2-enoate |
|---|---|
| PubChem CID | 143118762 |
| Molecular Formula | C32H27NO5 |
| Molecular Weight | 505.57 g/mol |
| Exact Mass | 505.19 |
| IUPAC Name | 3-[2-(9a-methyl-4a,9-dihydrofluoren-9-yl)-1,3-dioxobenzo[de]isoquinolin-6-yl]oxypropyl prop-2-enoate |
| SMILES | C=CC(=O)OCCCOc1ccc2c3c(cccc13)C(=O)N(C1c3ccccc3C3C=CC=CC31C)C2=O |
| InChI | InChI=1S/C32H27NO5/c1-3-27(34)38-19-9-18-37-26-16-15-24-28-22(26)12-8-13-23(28)30(35)33(31(24)36)29-21-11-5-4-10-20(21)25-14-6-7-17-32(25,29)2/h3-8,10-17,25,29H,1,9,18-19H2,2H3 |
| InChIKey | HDLDWTWVDZPFLM-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.57 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|