C24H24N2O3 — CID 11545544
2-[3-(3,4-dihydro-2H-quinoline-1-carbonyl)-1,2,3,4-tetrahydrocarbazol-9-yl]acetic acid (PubChem CID 11545544) has the molecular formula C24H24N2O3 and a molecular weight of 388.47 g/mol. Its IUPAC name is 2-[3-(3,4-dihydro-2H-quinoline-1-carbonyl)-1,2,3,4-tetrahydrocarbazol-9-yl]acetic acid.
| Compound Name | 2-[3-(3,4-dihydro-2H-quinoline-1-carbonyl)-1,2,3,4-tetrahydrocarbazol-9-yl]acetic acid |
|---|---|
| PubChem CID | 11545544 |
| Molecular Formula | C24H24N2O3 |
| Molecular Weight | 388.47 g/mol |
| Exact Mass | 388.18 |
| IUPAC Name | 2-[3-(3,4-dihydro-2H-quinoline-1-carbonyl)-1,2,3,4-tetrahydrocarbazol-9-yl]acetic acid |
| SMILES | O=C(O)Cn1c2c(c3ccccc31)CC(C(=O)N1CCCc3ccccc31)CC2 |
| InChI | InChI=1S/C24H24N2O3/c27-23(28)15-26-21-10-4-2-8-18(21)19-14-17(11-12-22(19)26)24(29)25-13-5-7-16-6-1-3-9-20(16)25/h1-4,6,8-10,17H,5,7,11-15H2,(H,27,28) |
| InChIKey | WPHHWFGRQREMNM-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 62.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.47 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|