4-(2,3-dimethylpiperidin-1-yl)-2-fluorobenzoic acid

C14H18FNO2 — CID 115485324

IUPAC4-(2,3-dimethylpiperidin-1-yl)-2-fluorobenzoic acid
SMILESCC1CCCN(c2ccc(C(=O)O)c(F)c2)C1C
InChIInChI=1S/C14H18FNO2/c1-9-4-3-7-16(10(9)2)11-5-6-12(14(17)18)13(15)8-11/h5-6,8-10H,3-4,7H2,1-2H3,(H,17,18)
InChIKeyOALMTYZJMZLSJY-UHFFFAOYSA-N
MW251.30 g/mol
LogP3.15
Rot. Bonds2

About 4-(2,3-dimethylpiperidin-1-yl)-2-fluorobenzoic acid

4-(2,3-dimethylpiperidin-1-yl)-2-fluorobenzoic acid (PubChem CID 115485324) has the molecular formula C14H18FNO2 and a molecular weight of 251.30 g/mol. Its IUPAC name is 4-(2,3-dimethylpiperidin-1-yl)-2-fluorobenzoic acid.

Molecular Properties

Compound Name4-(2,3-dimethylpiperidin-1-yl)-2-fluorobenzoic acid
PubChem CID115485324
Molecular FormulaC14H18FNO2
Molecular Weight251.30 g/mol
Exact Mass251.13
IUPAC Name4-(2,3-dimethylpiperidin-1-yl)-2-fluorobenzoic acid
SMILESCC1CCCN(c2ccc(C(=O)O)c(F)c2)C1C
InChIInChI=1S/C14H18FNO2/c1-9-4-3-7-16(10(9)2)11-5-6-12(14(17)18)13(15)8-11/h5-6,8-10H,3-4,7H2,1-2H3,(H,17,18)
InChIKeyOALMTYZJMZLSJY-UHFFFAOYSA-N
XLogP3.15
TPSA40.54 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds2
Heavy Atoms18
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500251.30
LogP ≤ 53.15
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze 4-(2,3-dimethylpiperidin-1-yl)-2-fluorobenzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-(2,3-dimethylpiperidin-1-yl)-2-fluorobenzoic acid?
The IUPAC name of 4-(2,3-dimethylpiperidin-1-yl)-2-fluorobenzoic acid (CID 115485324) is 4-(2,3-dimethylpiperidin-1-yl)-2-fluorobenzoic acid.
What is the SMILES notation for 4-(2,3-dimethylpiperidin-1-yl)-2-fluorobenzoic acid?
The canonical SMILES for 4-(2,3-dimethylpiperidin-1-yl)-2-fluorobenzoic acid is CC1CCCN(c2ccc(C(=O)O)c(F)c2)C1C.
What is the InChIKey of 4-(2,3-dimethylpiperidin-1-yl)-2-fluorobenzoic acid?
The InChIKey is OALMTYZJMZLSJY-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18FNO2/c1-9-4-3-7-16(10(9)2)11-5-6-12(14(17)18)13(15)8-11/h5-6,8-10H,3-4,7H2,1-2H3,(H,17,18).
What are the key properties of 4-(2,3-dimethylpiperidin-1-yl)-2-fluorobenzoic acid?
4-(2,3-dimethylpiperidin-1-yl)-2-fluorobenzoic acid has a molecular weight of 251.30 g/mol, XLogP of 3.15, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2,3-dimethylpiperidin-1-yl)-2-fluorobenzoic acid is sourced from PubChem (CID 115485324), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).