C43H38N4O3 — CID 11549206
benzyl (2R)-2-benzyl-4-[(5-methyl-3-tritylimidazol-4-yl)methyl]-3-oxo-2H-pyrazine-1-carboxylate (PubChem CID 11549206) has the molecular formula C43H38N4O3 and a molecular weight of 658.80 g/mol. Its IUPAC name is benzyl (2R)-2-benzyl-4-[(5-methyl-3-tritylimidazol-4-yl)methyl]-3-oxo-2H-pyrazine-1-carboxylate.
| Compound Name | benzyl (2R)-2-benzyl-4-[(5-methyl-3-tritylimidazol-4-yl)methyl]-3-oxo-2H-pyrazine-1-carboxylate |
|---|---|
| PubChem CID | 11549206 |
| Molecular Formula | C43H38N4O3 |
| Molecular Weight | 658.80 g/mol |
| Exact Mass | 658.29 |
| IUPAC Name | benzyl (2R)-2-benzyl-4-[(5-methyl-3-tritylimidazol-4-yl)methyl]-3-oxo-2H-pyrazine-1-carboxylate |
| SMILES | Cc1ncn(C(c2ccccc2)(c2ccccc2)c2ccccc2)c1CN1C=CN(C(=O)OCc2ccccc2)[C@H](Cc2ccccc2)C1=O |
| InChI | InChI=1S/C43H38N4O3/c1-33-40(47(32-44-33)43(36-21-11-4-12-22-36,37-23-13-5-14-24-37)38-25-15-6-16-26-38)30-45-27-28-46(42(49)50-31-35-19-9-3-10-20-35)39(41(45)48)29-34-17-7-2-8-18-34/h2-28,32,39H,29-31H2,1H3/t39-/m1/s1 |
| InChIKey | IJMRTNPWPRDQGC-LDLOPFEMSA-N |
| XLogP | 8.10 |
| TPSA | 67.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.80 |
| LogP ≤ 5 | 8.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|