C15H21NO2Sn — CID 11552342
trimethyl-[(2Z,4E)-4-methyl-5-(4-nitrophenyl)penta-2,4-dien-2-yl]stannane (PubChem CID 11552342) has the molecular formula C15H21NO2Sn and a molecular weight of 366.05 g/mol. Its IUPAC name is trimethyl-[(2Z,4E)-4-methyl-5-(4-nitrophenyl)penta-2,4-dien-2-yl]stannane.
| Compound Name | trimethyl-[(2Z,4E)-4-methyl-5-(4-nitrophenyl)penta-2,4-dien-2-yl]stannane |
|---|---|
| PubChem CID | 11552342 |
| Molecular Formula | C15H21NO2Sn |
| Molecular Weight | 366.05 g/mol |
| Exact Mass | 367.06 |
| IUPAC Name | trimethyl-[(2Z,4E)-4-methyl-5-(4-nitrophenyl)penta-2,4-dien-2-yl]stannane |
| SMILES | C/C(=C/C(C)=C/c1ccc([N+](=O)[O-])cc1)[Sn](C)(C)C |
| InChI | InChI=1S/C12H12NO2.3CH3.Sn/c1-3-4-10(2)9-11-5-7-12(8-6-11)13(14)15;;;;/h4-9H,1-2H3;3*1H3;/b4-3?,10-9+;;;; |
| InChIKey | AJDAQOZQTWVYON-YKHOUAJTSA-N |
| XLogP | 4.82 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.05 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|