C14H20N2O5 — CID 115537650
tert-butyl (2R)-1-[(5-nitrofuran-2-yl)methyl]pyrrolidine-2-carboxylate (PubChem CID 115537650) has the molecular formula C14H20N2O5 and a molecular weight of 296.32 g/mol. Its IUPAC name is tert-butyl (2R)-1-[(5-nitrofuran-2-yl)methyl]pyrrolidine-2-carboxylate.
| Compound Name | tert-butyl (2R)-1-[(5-nitrofuran-2-yl)methyl]pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 115537650 |
| Molecular Formula | C14H20N2O5 |
| Molecular Weight | 296.32 g/mol |
| Exact Mass | 296.14 |
| IUPAC Name | tert-butyl (2R)-1-[(5-nitrofuran-2-yl)methyl]pyrrolidine-2-carboxylate |
| SMILES | CC(C)(C)OC(=O)[C@H]1CCCN1Cc1ccc([N+](=O)[O-])o1 |
| InChI | InChI=1S/C14H20N2O5/c1-14(2,3)21-13(17)11-5-4-8-15(11)9-10-6-7-12(20-10)16(18)19/h6-7,11H,4-5,8-9H2,1-3H3/t11-/m1/s1 |
| InChIKey | JUJFTYHZLQIGNM-LLVKDONJSA-N |
| XLogP | 2.49 |
| TPSA | 85.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.32 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|