C13H15N3O2S — CID 115545249
2-amino-3-[(4-ethyl-5-methyl-1,3-thiazol-2-yl)amino]benzoic acid (PubChem CID 115545249) has the molecular formula C13H15N3O2S and a molecular weight of 277.35 g/mol. Its IUPAC name is 2-amino-3-[(4-ethyl-5-methyl-1,3-thiazol-2-yl)amino]benzoic acid.
| Compound Name | 2-amino-3-[(4-ethyl-5-methyl-1,3-thiazol-2-yl)amino]benzoic acid |
|---|---|
| PubChem CID | 115545249 |
| Molecular Formula | C13H15N3O2S |
| Molecular Weight | 277.35 g/mol |
| Exact Mass | 277.09 |
| IUPAC Name | 2-amino-3-[(4-ethyl-5-methyl-1,3-thiazol-2-yl)amino]benzoic acid |
| SMILES | CCc1nc(Nc2cccc(C(=O)O)c2N)sc1C |
| InChI | InChI=1S/C13H15N3O2S/c1-3-9-7(2)19-13(15-9)16-10-6-4-5-8(11(10)14)12(17)18/h4-6H,3,14H2,1-2H3,(H,15,16)(H,17,18) |
| InChIKey | OMJUHPFATLXETN-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 88.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.35 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|