C12H15N3S — CID 82057620
3-N-(4-ethyl-5-methyl-1,3-thiazol-2-yl)benzene-1,3-diamine (PubChem CID 82057620) has the molecular formula C12H15N3S and a molecular weight of 233.34 g/mol. Its IUPAC name is 3-N-(4-ethyl-5-methyl-1,3-thiazol-2-yl)benzene-1,3-diamine.
| Compound Name | 3-N-(4-ethyl-5-methyl-1,3-thiazol-2-yl)benzene-1,3-diamine |
|---|---|
| PubChem CID | 82057620 |
| Molecular Formula | C12H15N3S |
| Molecular Weight | 233.34 g/mol |
| Exact Mass | 233.10 |
| IUPAC Name | 3-N-(4-ethyl-5-methyl-1,3-thiazol-2-yl)benzene-1,3-diamine |
| SMILES | CCc1nc(Nc2cccc(N)c2)sc1C |
| InChI | InChI=1S/C12H15N3S/c1-3-11-8(2)16-12(15-11)14-10-6-4-5-9(13)7-10/h4-7H,3,13H2,1-2H3,(H,14,15) |
| InChIKey | WMTBAEVGDCVVOP-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.34 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|