C7H7N5S — CID 117044448
3-N-(thiatriazol-5-yl)benzene-1,3-diamine (PubChem CID 117044448) has the molecular formula C7H7N5S and a molecular weight of 193.24 g/mol. Its IUPAC name is 3-N-(thiatriazol-5-yl)benzene-1,3-diamine.
| Compound Name | 3-N-(thiatriazol-5-yl)benzene-1,3-diamine |
|---|---|
| PubChem CID | 117044448 |
| Molecular Formula | C7H7N5S |
| Molecular Weight | 193.24 g/mol |
| Exact Mass | 193.04 |
| IUPAC Name | 3-N-(thiatriazol-5-yl)benzene-1,3-diamine |
| SMILES | Nc1cccc(Nc2nnns2)c1 |
| InChI | InChI=1S/C7H7N5S/c8-5-2-1-3-6(4-5)9-7-10-11-12-13-7/h1-4H,8H2,(H,9,10,12) |
| InChIKey | XMBFEUSBHADMLJ-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 76.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.24 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|