C9H7F3N4S — CID 107304605
3-N-[3-(trifluoromethyl)-1,2,4-thiadiazol-5-yl]benzene-1,3-diamine (PubChem CID 107304605) has the molecular formula C9H7F3N4S and a molecular weight of 260.24 g/mol. Its IUPAC name is 3-N-[3-(trifluoromethyl)-1,2,4-thiadiazol-5-yl]benzene-1,3-diamine.
| Compound Name | 3-N-[3-(trifluoromethyl)-1,2,4-thiadiazol-5-yl]benzene-1,3-diamine |
|---|---|
| PubChem CID | 107304605 |
| Molecular Formula | C9H7F3N4S |
| Molecular Weight | 260.24 g/mol |
| Exact Mass | 260.03 |
| IUPAC Name | 3-N-[3-(trifluoromethyl)-1,2,4-thiadiazol-5-yl]benzene-1,3-diamine |
| SMILES | Nc1cccc(Nc2nc(C(F)(F)F)ns2)c1 |
| InChI | InChI=1S/C9H7F3N4S/c10-9(11,12)7-15-8(17-16-7)14-6-3-1-2-5(13)4-6/h1-4H,13H2,(H,14,15,16) |
| InChIKey | HCBZDTVOSOACKB-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.24 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|