C18H20N2S — CID 115551695
3-(4-butylphenyl)-4-methyl-1H-benzimidazole-2-thione (PubChem CID 115551695) has the molecular formula C18H20N2S and a molecular weight of 296.44 g/mol. Its IUPAC name is 3-(4-butylphenyl)-4-methyl-1H-benzimidazole-2-thione.
| Compound Name | 3-(4-butylphenyl)-4-methyl-1H-benzimidazole-2-thione |
|---|---|
| PubChem CID | 115551695 |
| Molecular Formula | C18H20N2S |
| Molecular Weight | 296.44 g/mol |
| Exact Mass | 296.13 |
| IUPAC Name | 3-(4-butylphenyl)-4-methyl-1H-benzimidazole-2-thione |
| SMILES | CCCCc1ccc(-n2c(=S)[nH]c3cccc(C)c32)cc1 |
| InChI | InChI=1S/C18H20N2S/c1-3-4-7-14-9-11-15(12-10-14)20-17-13(2)6-5-8-16(17)19-18(20)21/h5-6,8-12H,3-4,7H2,1-2H3,(H,19,21) |
| InChIKey | ZLRBCWHPQBNXGR-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 20.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.44 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|