C13H17Cl2NO2 — CID 115556380
1-chloro-5-(2-chloro-3,3-dimethylbutyl)-4-methyl-2-nitrobenzene (PubChem CID 115556380) has the molecular formula C13H17Cl2NO2 and a molecular weight of 290.19 g/mol. Its IUPAC name is 1-chloro-5-(2-chloro-3,3-dimethylbutyl)-4-methyl-2-nitrobenzene.
| Compound Name | 1-chloro-5-(2-chloro-3,3-dimethylbutyl)-4-methyl-2-nitrobenzene |
|---|---|
| PubChem CID | 115556380 |
| Molecular Formula | C13H17Cl2NO2 |
| Molecular Weight | 290.19 g/mol |
| Exact Mass | 289.06 |
| IUPAC Name | 1-chloro-5-(2-chloro-3,3-dimethylbutyl)-4-methyl-2-nitrobenzene |
| SMILES | Cc1cc([N+](=O)[O-])c(Cl)cc1CC(Cl)C(C)(C)C |
| InChI | InChI=1S/C13H17Cl2NO2/c1-8-5-11(16(17)18)10(14)6-9(8)7-12(15)13(2,3)4/h5-6,12H,7H2,1-4H3 |
| InChIKey | KSIBENGSHABUDQ-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.19 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|