C12H17ClN2O2 — CID 63202846
2-(2-chloro-3,3-dimethylbutyl)-3-methyl-5-nitropyridine (PubChem CID 63202846) has the molecular formula C12H17ClN2O2 and a molecular weight of 256.73 g/mol. Its IUPAC name is 2-(2-chloro-3,3-dimethylbutyl)-3-methyl-5-nitropyridine.
| Compound Name | 2-(2-chloro-3,3-dimethylbutyl)-3-methyl-5-nitropyridine |
|---|---|
| PubChem CID | 63202846 |
| Molecular Formula | C12H17ClN2O2 |
| Molecular Weight | 256.73 g/mol |
| Exact Mass | 256.10 |
| IUPAC Name | 2-(2-chloro-3,3-dimethylbutyl)-3-methyl-5-nitropyridine |
| SMILES | Cc1cc([N+](=O)[O-])cnc1CC(Cl)C(C)(C)C |
| InChI | InChI=1S/C12H17ClN2O2/c1-8-5-9(15(16)17)7-14-10(8)6-11(13)12(2,3)4/h5,7,11H,6H2,1-4H3 |
| InChIKey | KDBLSJNBRHVLKT-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 56.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.73 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|