C14H17ClN2O3S — CID 115561055
2-(3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-2-carbonyl)-3-chlorobenzenesulfonamide (PubChem CID 115561055) has the molecular formula C14H17ClN2O3S and a molecular weight of 328.82 g/mol. Its IUPAC name is 2-(3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-2-carbonyl)-3-chlorobenzenesulfonamide.
| Compound Name | 2-(3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-2-carbonyl)-3-chlorobenzenesulfonamide |
|---|---|
| PubChem CID | 115561055 |
| Molecular Formula | C14H17ClN2O3S |
| Molecular Weight | 328.82 g/mol |
| Exact Mass | 328.06 |
| IUPAC Name | 2-(3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-2-carbonyl)-3-chlorobenzenesulfonamide |
| SMILES | NS(=O)(=O)c1cccc(Cl)c1C(=O)N1CC2CCCC2C1 |
| InChI | InChI=1S/C14H17ClN2O3S/c15-11-5-2-6-12(21(16,19)20)13(11)14(18)17-7-9-3-1-4-10(9)8-17/h2,5-6,9-10H,1,3-4,7-8H2,(H2,16,19,20) |
| InChIKey | FTPNTGCYVFOSAY-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.82 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |