C21H18F3NO3 — CID 11560164
3-methyl-2,6-dioxo-3-phenyl-N-[3-(trifluoromethyl)phenyl]cyclohexane-1-carboxamide (PubChem CID 11560164) has the molecular formula C21H18F3NO3 and a molecular weight of 389.37 g/mol. Its IUPAC name is 3-methyl-2,6-dioxo-3-phenyl-N-[3-(trifluoromethyl)phenyl]cyclohexane-1-carboxamide.
| Compound Name | 3-methyl-2,6-dioxo-3-phenyl-N-[3-(trifluoromethyl)phenyl]cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 11560164 |
| Molecular Formula | C21H18F3NO3 |
| Molecular Weight | 389.37 g/mol |
| Exact Mass | 389.12 |
| IUPAC Name | 3-methyl-2,6-dioxo-3-phenyl-N-[3-(trifluoromethyl)phenyl]cyclohexane-1-carboxamide |
| SMILES | CC1(c2ccccc2)CCC(=O)C(C(=O)Nc2cccc(C(F)(F)F)c2)C1=O |
| InChI | InChI=1S/C21H18F3NO3/c1-20(13-6-3-2-4-7-13)11-10-16(26)17(18(20)27)19(28)25-15-9-5-8-14(12-15)21(22,23)24/h2-9,12,17H,10-11H2,1H3,(H,25,28) |
| InChIKey | LHWAPJGXXPJSRQ-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.37 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|