C8H14F2N2 — CID 115611801
5-[2,2-difluoroethyl(methyl)amino]pentanenitrile (PubChem CID 115611801) has the molecular formula C8H14F2N2 and a molecular weight of 176.21 g/mol. Its IUPAC name is 5-[2,2-difluoroethyl(methyl)amino]pentanenitrile.
| Compound Name | 5-[2,2-difluoroethyl(methyl)amino]pentanenitrile |
|---|---|
| PubChem CID | 115611801 |
| Molecular Formula | C8H14F2N2 |
| Molecular Weight | 176.21 g/mol |
| Exact Mass | 176.11 |
| IUPAC Name | 5-[2,2-difluoroethyl(methyl)amino]pentanenitrile |
| SMILES | CN(CCCCC#N)CC(F)F |
| InChI | InChI=1S/C8H14F2N2/c1-12(7-8(9)10)6-4-2-3-5-11/h8H,2-4,6-7H2,1H3 |
| InChIKey | GCTWWBBEXSPESW-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.21 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|