C25H25N3O3S — CID 11561417
1,1-dioxo-5-phenyl-4-(4-phenylbutylamino)-2-(pyridin-2-ylmethyl)-1,2-thiazol-3-one (PubChem CID 11561417) has the molecular formula C25H25N3O3S and a molecular weight of 447.56 g/mol. Its IUPAC name is 1,1-dioxo-5-phenyl-4-(4-phenylbutylamino)-2-(pyridin-2-ylmethyl)-1,2-thiazol-3-one.
| Compound Name | 1,1-dioxo-5-phenyl-4-(4-phenylbutylamino)-2-(pyridin-2-ylmethyl)-1,2-thiazol-3-one |
|---|---|
| PubChem CID | 11561417 |
| Molecular Formula | C25H25N3O3S |
| Molecular Weight | 447.56 g/mol |
| Exact Mass | 447.16 |
| IUPAC Name | 1,1-dioxo-5-phenyl-4-(4-phenylbutylamino)-2-(pyridin-2-ylmethyl)-1,2-thiazol-3-one |
| SMILES | O=C1C(NCCCCc2ccccc2)=C(c2ccccc2)S(=O)(=O)N1Cc1ccccn1 |
| InChI | InChI=1S/C25H25N3O3S/c29-25-23(27-18-9-7-13-20-11-3-1-4-12-20)24(21-14-5-2-6-15-21)32(30,31)28(25)19-22-16-8-10-17-26-22/h1-6,8,10-12,14-17,27H,7,9,13,18-19H2 |
| InChIKey | RGSGTWJMLUIABN-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.56 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|