C26H24FN7O3 — CID 11562416
6-N-[(4-fluoro-3-methoxyphenyl)methyl]-4-N-[(1S)-5-(5-methyl-1H-1,2,4-triazol-3-yl)-2,3-dihydro-1H-inden-1-yl]pyrimidine-4,6-dicarboxamide (PubChem CID 11562416) has the molecular formula C26H24FN7O3 and a molecular weight of 501.52 g/mol. Its IUPAC name is 6-N-[(4-fluoro-3-methoxyphenyl)methyl]-4-N-[(1S)-5-(5-methyl-1H-1,2,4-triazol-3-yl)-2,3-dihydro-1H-inden-1-yl]pyrimidine-4,6-dicarboxamide.
| Compound Name | 6-N-[(4-fluoro-3-methoxyphenyl)methyl]-4-N-[(1S)-5-(5-methyl-1H-1,2,4-triazol-3-yl)-2,3-dihydro-1H-inden-1-yl]pyrimidine-4,6-dicarboxamide |
|---|---|
| PubChem CID | 11562416 |
| Molecular Formula | C26H24FN7O3 |
| Molecular Weight | 501.52 g/mol |
| Exact Mass | 501.19 |
| IUPAC Name | 6-N-[(4-fluoro-3-methoxyphenyl)methyl]-4-N-[(1S)-5-(5-methyl-1H-1,2,4-triazol-3-yl)-2,3-dihydro-1H-inden-1-yl]pyrimidine-4,6-dicarboxamide |
| SMILES | COc1cc(CNC(=O)c2cc(C(=O)N[C@H]3CCc4cc(-c5n[nH]c(C)n5)ccc43)ncn2)ccc1F |
| InChI | InChI=1S/C26H24FN7O3/c1-14-31-24(34-33-14)17-4-6-18-16(10-17)5-8-20(18)32-26(36)22-11-21(29-13-30-22)25(35)28-12-15-3-7-19(27)23(9-15)37-2/h3-4,6-7,9-11,13,20H,5,8,12H2,1-2H3,(H,28,35)(H,32,36)(H,31,33,34)/t20-/m0/s1 |
| InChIKey | IKIULXANWNSGOM-FQEVSTJZSA-N |
| XLogP | 3.07 |
| TPSA | 134.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.52 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |