C26H21F4N7O3 — CID 11592104
6-N-[[4-fluoro-3-(trifluoromethoxy)phenyl]methyl]-4-N-[(1S)-5-(5-methyl-1H-1,2,4-triazol-3-yl)-2,3-dihydro-1H-inden-1-yl]pyrimidine-4,6-dicarboxamide (PubChem CID 11592104) has the molecular formula C26H21F4N7O3 and a molecular weight of 555.49 g/mol. Its IUPAC name is 6-N-[[4-fluoro-3-(trifluoromethoxy)phenyl]methyl]-4-N-[(1S)-5-(5-methyl-1H-1,2,4-triazol-3-yl)-2,3-dihydro-1H-inden-1-yl]pyrimidine-4,6-dicarboxamide.
| Compound Name | 6-N-[[4-fluoro-3-(trifluoromethoxy)phenyl]methyl]-4-N-[(1S)-5-(5-methyl-1H-1,2,4-triazol-3-yl)-2,3-dihydro-1H-inden-1-yl]pyrimidine-4,6-dicarboxamide |
|---|---|
| PubChem CID | 11592104 |
| Molecular Formula | C26H21F4N7O3 |
| Molecular Weight | 555.49 g/mol |
| Exact Mass | 555.16 |
| IUPAC Name | 6-N-[[4-fluoro-3-(trifluoromethoxy)phenyl]methyl]-4-N-[(1S)-5-(5-methyl-1H-1,2,4-triazol-3-yl)-2,3-dihydro-1H-inden-1-yl]pyrimidine-4,6-dicarboxamide |
| SMILES | Cc1nc(-c2ccc3c(c2)CC[C@@H]3NC(=O)c2cc(C(=O)NCc3ccc(F)c(OC(F)(F)F)c3)ncn2)n[nH]1 |
| InChI | InChI=1S/C26H21F4N7O3/c1-13-34-23(37-36-13)16-3-5-17-15(9-16)4-7-19(17)35-25(39)21-10-20(32-12-33-21)24(38)31-11-14-2-6-18(27)22(8-14)40-26(28,29)30/h2-3,5-6,8-10,12,19H,4,7,11H2,1H3,(H,31,38)(H,35,39)(H,34,36,37)/t19-/m0/s1 |
| InChIKey | YGAAAJWTZPRXLN-IBGZPJMESA-N |
| XLogP | 3.96 |
| TPSA | 134.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.49 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |