C13H19NO — CID 115624951
1-(1-methoxypropan-2-yl)-2,3-dihydroinden-1-amine (PubChem CID 115624951) has the molecular formula C13H19NO and a molecular weight of 205.30 g/mol. Its IUPAC name is 1-(1-methoxypropan-2-yl)-2,3-dihydroinden-1-amine.
| Compound Name | 1-(1-methoxypropan-2-yl)-2,3-dihydroinden-1-amine |
|---|---|
| PubChem CID | 115624951 |
| Molecular Formula | C13H19NO |
| Molecular Weight | 205.30 g/mol |
| Exact Mass | 205.15 |
| IUPAC Name | 1-(1-methoxypropan-2-yl)-2,3-dihydroinden-1-amine |
| SMILES | COCC(C)C1(N)CCc2ccccc21 |
| InChI | InChI=1S/C13H19NO/c1-10(9-15-2)13(14)8-7-11-5-3-4-6-12(11)13/h3-6,10H,7-9,14H2,1-2H3 |
| InChIKey | JJPHYZIVBZRUAE-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.30 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |