C9H18F3NO2 — CID 115638162
2-methyl-2-[methyl-[2-(2,2,2-trifluoroethoxy)ethyl]amino]propan-1-ol (PubChem CID 115638162) has the molecular formula C9H18F3NO2 and a molecular weight of 229.24 g/mol. Its IUPAC name is 2-methyl-2-[methyl-[2-(2,2,2-trifluoroethoxy)ethyl]amino]propan-1-ol.
| Compound Name | 2-methyl-2-[methyl-[2-(2,2,2-trifluoroethoxy)ethyl]amino]propan-1-ol |
|---|---|
| PubChem CID | 115638162 |
| Molecular Formula | C9H18F3NO2 |
| Molecular Weight | 229.24 g/mol |
| Exact Mass | 229.13 |
| IUPAC Name | 2-methyl-2-[methyl-[2-(2,2,2-trifluoroethoxy)ethyl]amino]propan-1-ol |
| SMILES | CN(CCOCC(F)(F)F)C(C)(C)CO |
| InChI | InChI=1S/C9H18F3NO2/c1-8(2,6-14)13(3)4-5-15-7-9(10,11)12/h14H,4-7H2,1-3H3 |
| InChIKey | KYBFFHJOBPZFKX-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.24 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|