C15H20Cl2N2 — CID 115651127
5-[2-(2,4-dichlorophenyl)ethylamino]-4,4-dimethylpentanenitrile (PubChem CID 115651127) has the molecular formula C15H20Cl2N2 and a molecular weight of 299.24 g/mol. Its IUPAC name is 5-[2-(2,4-dichlorophenyl)ethylamino]-4,4-dimethylpentanenitrile.
| Compound Name | 5-[2-(2,4-dichlorophenyl)ethylamino]-4,4-dimethylpentanenitrile |
|---|---|
| PubChem CID | 115651127 |
| Molecular Formula | C15H20Cl2N2 |
| Molecular Weight | 299.24 g/mol |
| Exact Mass | 298.10 |
| IUPAC Name | 5-[2-(2,4-dichlorophenyl)ethylamino]-4,4-dimethylpentanenitrile |
| SMILES | CC(C)(CCC#N)CNCCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C15H20Cl2N2/c1-15(2,7-3-8-18)11-19-9-6-12-4-5-13(16)10-14(12)17/h4-5,10,19H,3,6-7,9,11H2,1-2H3 |
| InChIKey | JXCYOZRDSICZFM-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.24 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|