C14H16Cl2N2 — CID 65482531
2-[1-[[2-(2,4-dichlorophenyl)ethylamino]methyl]cyclopropyl]acetonitrile (PubChem CID 65482531) has the molecular formula C14H16Cl2N2 and a molecular weight of 283.20 g/mol. Its IUPAC name is 2-[1-[[2-(2,4-dichlorophenyl)ethylamino]methyl]cyclopropyl]acetonitrile.
| Compound Name | 2-[1-[[2-(2,4-dichlorophenyl)ethylamino]methyl]cyclopropyl]acetonitrile |
|---|---|
| PubChem CID | 65482531 |
| Molecular Formula | C14H16Cl2N2 |
| Molecular Weight | 283.20 g/mol |
| Exact Mass | 282.07 |
| IUPAC Name | 2-[1-[[2-(2,4-dichlorophenyl)ethylamino]methyl]cyclopropyl]acetonitrile |
| SMILES | N#CCC1(CNCCc2ccc(Cl)cc2Cl)CC1 |
| InChI | InChI=1S/C14H16Cl2N2/c15-12-2-1-11(13(16)9-12)3-8-18-10-14(4-5-14)6-7-17/h1-2,9,18H,3-6,8,10H2 |
| InChIKey | JOOSGLVTVJJAPO-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.20 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|