C13H10ClFN4 — CID 11565348
3-[[5-chloro-6-(1-fluoroethyl)pyrimidin-4-yl]amino]benzonitrile (PubChem CID 11565348) has the molecular formula C13H10ClFN4 and a molecular weight of 276.70 g/mol. Its IUPAC name is 3-[[5-chloro-6-(1-fluoroethyl)pyrimidin-4-yl]amino]benzonitrile.
| Compound Name | 3-[[5-chloro-6-(1-fluoroethyl)pyrimidin-4-yl]amino]benzonitrile |
|---|---|
| PubChem CID | 11565348 |
| Molecular Formula | C13H10ClFN4 |
| Molecular Weight | 276.70 g/mol |
| Exact Mass | 276.06 |
| IUPAC Name | 3-[[5-chloro-6-(1-fluoroethyl)pyrimidin-4-yl]amino]benzonitrile |
| SMILES | CC(F)c1ncnc(Nc2cccc(C#N)c2)c1Cl |
| InChI | InChI=1S/C13H10ClFN4/c1-8(15)12-11(14)13(18-7-17-12)19-10-4-2-3-9(5-10)6-16/h2-5,7-8H,1H3,(H,17,18,19) |
| InChIKey | VWJJOIIPFXVZTM-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 61.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.70 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |