C11H13N3OS — CID 115675832
5-[[(6-oxopiperidin-3-yl)amino]methyl]thiophene-2-carbonitrile (PubChem CID 115675832) has the molecular formula C11H13N3OS and a molecular weight of 235.31 g/mol. Its IUPAC name is 5-[[(6-oxopiperidin-3-yl)amino]methyl]thiophene-2-carbonitrile.
| Compound Name | 5-[[(6-oxopiperidin-3-yl)amino]methyl]thiophene-2-carbonitrile |
|---|---|
| PubChem CID | 115675832 |
| Molecular Formula | C11H13N3OS |
| Molecular Weight | 235.31 g/mol |
| Exact Mass | 235.08 |
| IUPAC Name | 5-[[(6-oxopiperidin-3-yl)amino]methyl]thiophene-2-carbonitrile |
| SMILES | N#Cc1ccc(CNC2CCC(=O)NC2)s1 |
| InChI | InChI=1S/C11H13N3OS/c12-5-9-2-3-10(16-9)7-13-8-1-4-11(15)14-6-8/h2-3,8,13H,1,4,6-7H2,(H,14,15) |
| InChIKey | XIGIMVFKSFOCGJ-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 64.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.31 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |