About N-[(2-chloro-1,3-thiazol-5-yl)methyl]-2,2-difluoro-N-methylethanamine
N-[(2-chloro-1,3-thiazol-5-yl)methyl]-2,2-difluoro-N-methylethanamine (PubChem CID 115681800) has the molecular formula C7H9ClF2N2S
and a molecular weight of 226.68 g/mol. Its IUPAC name is N-[(2-chloro-1,3-thiazol-5-yl)methyl]-2,2-difluoro-N-methylethanamine.
Molecular Properties
| Compound Name | N-[(2-chloro-1,3-thiazol-5-yl)methyl]-2,2-difluoro-N-methylethanamine |
| PubChem CID | 115681800 |
| Molecular Formula | C7H9ClF2N2S |
| Molecular Weight | 226.68 g/mol |
| Exact Mass | 226.01 |
| IUPAC Name | N-[(2-chloro-1,3-thiazol-5-yl)methyl]-2,2-difluoro-N-methylethanamine |
| SMILES | CN(Cc1cnc(Cl)s1)CC(F)F |
| InChI | InChI=1S/C7H9ClF2N2S/c1-12(4-6(9)10)3-5-2-11-7(8)13-5/h2,6H,3-4H2,1H3 |
| InChIKey | UWMIIGZJBBNJBQ-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.68 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[(2-chloro-1,3-thiazol-5-yl)methyl]-2,2-difluoro-N-methylethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(2-chloro-1,3-thiazol-5-yl)methyl]-2,2-difluoro-N-methylethanamine?
The IUPAC name of N-[(2-chloro-1,3-thiazol-5-yl)methyl]-2,2-difluoro-N-methylethanamine (CID 115681800) is N-[(2-chloro-1,3-thiazol-5-yl)methyl]-2,2-difluoro-N-methylethanamine.
What is the SMILES notation for N-[(2-chloro-1,3-thiazol-5-yl)methyl]-2,2-difluoro-N-methylethanamine?
The canonical SMILES for N-[(2-chloro-1,3-thiazol-5-yl)methyl]-2,2-difluoro-N-methylethanamine is CN(Cc1cnc(Cl)s1)CC(F)F.
What is the InChIKey of N-[(2-chloro-1,3-thiazol-5-yl)methyl]-2,2-difluoro-N-methylethanamine?
The InChIKey is UWMIIGZJBBNJBQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9ClF2N2S/c1-12(4-6(9)10)3-5-2-11-7(8)13-5/h2,6H,3-4H2,1H3.
What are the key properties of N-[(2-chloro-1,3-thiazol-5-yl)methyl]-2,2-difluoro-N-methylethanamine?
N-[(2-chloro-1,3-thiazol-5-yl)methyl]-2,2-difluoro-N-methylethanamine has a molecular weight of 226.68 g/mol, XLogP of 2.49, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(2-chloro-1,3-thiazol-5-yl)methyl]-2,2-difluoro-N-methylethanamine is sourced from PubChem (CID 115681800), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).