C27H25N3O3 — CID 11568361
(2R,10S)-10-amino-2-(7-phenylmethoxy-2H-chromen-3-yl)-1,3-diazatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-4-one (PubChem CID 11568361) has the molecular formula C27H25N3O3 and a molecular weight of 439.52 g/mol. Its IUPAC name is (2R,10S)-10-amino-2-(7-phenylmethoxy-2H-chromen-3-yl)-1,3-diazatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-4-one.
| Compound Name | (2R,10S)-10-amino-2-(7-phenylmethoxy-2H-chromen-3-yl)-1,3-diazatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-4-one |
|---|---|
| PubChem CID | 11568361 |
| Molecular Formula | C27H25N3O3 |
| Molecular Weight | 439.52 g/mol |
| Exact Mass | 439.19 |
| IUPAC Name | (2R,10S)-10-amino-2-(7-phenylmethoxy-2H-chromen-3-yl)-1,3-diazatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-4-one |
| SMILES | N[C@H]1CCN2c3c(cccc31)C(=O)N[C@H]2C1=Cc2ccc(OCc3ccccc3)cc2OC1 |
| InChI | InChI=1S/C27H25N3O3/c28-23-11-12-30-25-21(23)7-4-8-22(25)27(31)29-26(30)19-13-18-9-10-20(14-24(18)33-16-19)32-15-17-5-2-1-3-6-17/h1-10,13-14,23,26H,11-12,15-16,28H2,(H,29,31)/t23-,26+/m0/s1 |
| InChIKey | UYTRJWYQZBKTRL-JYFHCDHNSA-N |
| XLogP | 4.02 |
| TPSA | 76.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.52 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |