C9H13BrN4O — CID 115685581
5-[(2-bromoprop-2-enylamino)methyl]-6-methoxypyrimidin-4-amine (PubChem CID 115685581) has the molecular formula C9H13BrN4O and a molecular weight of 273.13 g/mol. Its IUPAC name is 5-[(2-bromoprop-2-enylamino)methyl]-6-methoxypyrimidin-4-amine.
| Compound Name | 5-[(2-bromoprop-2-enylamino)methyl]-6-methoxypyrimidin-4-amine |
|---|---|
| PubChem CID | 115685581 |
| Molecular Formula | C9H13BrN4O |
| Molecular Weight | 273.13 g/mol |
| Exact Mass | 272.03 |
| IUPAC Name | 5-[(2-bromoprop-2-enylamino)methyl]-6-methoxypyrimidin-4-amine |
| SMILES | C=C(Br)CNCc1c(N)ncnc1OC |
| InChI | InChI=1S/C9H13BrN4O/c1-6(10)3-12-4-7-8(11)13-5-14-9(7)15-2/h5,12H,1,3-4H2,2H3,(H2,11,13,14) |
| InChIKey | XOECTTKGFGQZDM-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.13 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |