About 4-bromo-N-(1,4-dithian-2-ylmethyl)-1-propan-2-ylpyrrole-2-carboxamide
4-bromo-N-(1,4-dithian-2-ylmethyl)-1-propan-2-ylpyrrole-2-carboxamide (PubChem CID 115687010) has the molecular formula C13H19BrN2OS2
and a molecular weight of 363.35 g/mol. Its IUPAC name is 4-bromo-N-(1,4-dithian-2-ylmethyl)-1-propan-2-ylpyrrole-2-carboxamide.
Molecular Properties
| Compound Name | 4-bromo-N-(1,4-dithian-2-ylmethyl)-1-propan-2-ylpyrrole-2-carboxamide |
| PubChem CID | 115687010 |
| Molecular Formula | C13H19BrN2OS2 |
| Molecular Weight | 363.35 g/mol |
| Exact Mass | 362.01 |
| IUPAC Name | 4-bromo-N-(1,4-dithian-2-ylmethyl)-1-propan-2-ylpyrrole-2-carboxamide |
| SMILES | CC(C)n1cc(Br)cc1C(=O)NCC1CSCCS1 |
| InChI | InChI=1S/C13H19BrN2OS2/c1-9(2)16-7-10(14)5-12(16)13(17)15-6-11-8-18-3-4-19-11/h5,7,9,11H,3-4,6,8H2,1-2H3,(H,15,17) |
| InChIKey | CQGQQCXSJLISAM-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 363.35 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-bromo-N-(1,4-dithian-2-ylmethyl)-1-propan-2-ylpyrrole-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromo-N-(1,4-dithian-2-ylmethyl)-1-propan-2-ylpyrrole-2-carboxamide?
The IUPAC name of 4-bromo-N-(1,4-dithian-2-ylmethyl)-1-propan-2-ylpyrrole-2-carboxamide (CID 115687010) is 4-bromo-N-(1,4-dithian-2-ylmethyl)-1-propan-2-ylpyrrole-2-carboxamide.
What is the SMILES notation for 4-bromo-N-(1,4-dithian-2-ylmethyl)-1-propan-2-ylpyrrole-2-carboxamide?
The canonical SMILES for 4-bromo-N-(1,4-dithian-2-ylmethyl)-1-propan-2-ylpyrrole-2-carboxamide is CC(C)n1cc(Br)cc1C(=O)NCC1CSCCS1.
What is the InChIKey of 4-bromo-N-(1,4-dithian-2-ylmethyl)-1-propan-2-ylpyrrole-2-carboxamide?
The InChIKey is CQGQQCXSJLISAM-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19BrN2OS2/c1-9(2)16-7-10(14)5-12(16)13(17)15-6-11-8-18-3-4-19-11/h5,7,9,11H,3-4,6,8H2,1-2H3,(H,15,17).
What are the key properties of 4-bromo-N-(1,4-dithian-2-ylmethyl)-1-propan-2-ylpyrrole-2-carboxamide?
4-bromo-N-(1,4-dithian-2-ylmethyl)-1-propan-2-ylpyrrole-2-carboxamide has a molecular weight of 363.35 g/mol, XLogP of 3.41, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromo-N-(1,4-dithian-2-ylmethyl)-1-propan-2-ylpyrrole-2-carboxamide is sourced from PubChem (CID 115687010), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).