C8H10F3N3O — CID 115692392
N-(4-ethyl-1H-pyrazol-5-yl)-3,3,3-trifluoropropanamide (PubChem CID 115692392) has the molecular formula C8H10F3N3O and a molecular weight of 221.18 g/mol. Its IUPAC name is N-(4-ethyl-1H-pyrazol-5-yl)-3,3,3-trifluoropropanamide.
| Compound Name | N-(4-ethyl-1H-pyrazol-5-yl)-3,3,3-trifluoropropanamide |
|---|---|
| PubChem CID | 115692392 |
| Molecular Formula | C8H10F3N3O |
| Molecular Weight | 221.18 g/mol |
| Exact Mass | 221.08 |
| IUPAC Name | N-(4-ethyl-1H-pyrazol-5-yl)-3,3,3-trifluoropropanamide |
| SMILES | CCc1cn[nH]c1NC(=O)CC(F)(F)F |
| InChI | InChI=1S/C8H10F3N3O/c1-2-5-4-12-14-7(5)13-6(15)3-8(9,10)11/h4H,2-3H2,1H3,(H2,12,13,14,15) |
| InChIKey | HSDOCINHBPKBCJ-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.18 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |