C11H17ClN2O — CID 115693309
N-[(4-chloro-1-methylpyrrol-2-yl)methyl]oxan-4-amine (PubChem CID 115693309) has the molecular formula C11H17ClN2O and a molecular weight of 228.72 g/mol. Its IUPAC name is N-[(4-chloro-1-methylpyrrol-2-yl)methyl]oxan-4-amine.
| Compound Name | N-[(4-chloro-1-methylpyrrol-2-yl)methyl]oxan-4-amine |
|---|---|
| PubChem CID | 115693309 |
| Molecular Formula | C11H17ClN2O |
| Molecular Weight | 228.72 g/mol |
| Exact Mass | 228.10 |
| IUPAC Name | N-[(4-chloro-1-methylpyrrol-2-yl)methyl]oxan-4-amine |
| SMILES | Cn1cc(Cl)cc1CNC1CCOCC1 |
| InChI | InChI=1S/C11H17ClN2O/c1-14-8-9(12)6-11(14)7-13-10-2-4-15-5-3-10/h6,8,10,13H,2-5,7H2,1H3 |
| InChIKey | ZFMHKZHFQVLUQL-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 26.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.72 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |