C29H31F2N2O3+ — CID 11570510
[(3R)-1-(2-phenoxyethyl)-1-azoniabicyclo[2.2.2]octan-3-yl] N-(3-fluorophenyl)-N-[(3-fluorophenyl)methyl]carbamate (PubChem CID 11570510) has the molecular formula C29H31F2N2O3+ and a molecular weight of 493.57 g/mol. Its IUPAC name is [(3R)-1-(2-phenoxyethyl)-1-azoniabicyclo[2.2.2]octan-3-yl] N-(3-fluorophenyl)-N-[(3-fluorophenyl)methyl]carbamate.
| Compound Name | [(3R)-1-(2-phenoxyethyl)-1-azoniabicyclo[2.2.2]octan-3-yl] N-(3-fluorophenyl)-N-[(3-fluorophenyl)methyl]carbamate |
|---|---|
| PubChem CID | 11570510 |
| Molecular Formula | C29H31F2N2O3+ |
| Molecular Weight | 493.57 g/mol |
| Exact Mass | 493.23 |
| IUPAC Name | [(3R)-1-(2-phenoxyethyl)-1-azoniabicyclo[2.2.2]octan-3-yl] N-(3-fluorophenyl)-N-[(3-fluorophenyl)methyl]carbamate |
| SMILES | O=C(O[C@H]1C[N+]2(CCOc3ccccc3)CCC1CC2)N(Cc1cccc(F)c1)c1cccc(F)c1 |
| InChI | InChI=1S/C29H31F2N2O3/c30-24-7-4-6-22(18-24)20-32(26-9-5-8-25(31)19-26)29(34)36-28-21-33(14-12-23(28)13-15-33)16-17-35-27-10-2-1-3-11-27/h1-11,18-19,23,28H,12-17,20-21H2/q+1/t23?,28-,33?/m0/s1 |
| InChIKey | NOZVXMJLWNBZBB-YIPDAYQMSA-N |
| XLogP | 5.80 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.57 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|