C19H15NO4 — CID 11573319
6-methyl-3,4-dioxo-N-(4-phenylphenyl)pyran-2-carboxamide (PubChem CID 11573319) has the molecular formula C19H15NO4 and a molecular weight of 321.33 g/mol. Its IUPAC name is 6-methyl-3,4-dioxo-N-(4-phenylphenyl)pyran-2-carboxamide.
| Compound Name | 6-methyl-3,4-dioxo-N-(4-phenylphenyl)pyran-2-carboxamide |
|---|---|
| PubChem CID | 11573319 |
| Molecular Formula | C19H15NO4 |
| Molecular Weight | 321.33 g/mol |
| Exact Mass | 321.10 |
| IUPAC Name | 6-methyl-3,4-dioxo-N-(4-phenylphenyl)pyran-2-carboxamide |
| SMILES | CC1=CC(=O)C(=O)C(C(=O)Nc2ccc(-c3ccccc3)cc2)O1 |
| InChI | InChI=1S/C19H15NO4/c1-12-11-16(21)17(22)18(24-12)19(23)20-15-9-7-14(8-10-15)13-5-3-2-4-6-13/h2-11,18H,1H3,(H,20,23) |
| InChIKey | YIIQXHUUMGERBA-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.33 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|