C8H15ClN2O — CID 115734359
2-amino-N-(2-chloroprop-2-enyl)-3-methylbutanamide (PubChem CID 115734359) has the molecular formula C8H15ClN2O and a molecular weight of 190.67 g/mol. Its IUPAC name is 2-amino-N-(2-chloroprop-2-enyl)-3-methylbutanamide.
| Compound Name | 2-amino-N-(2-chloroprop-2-enyl)-3-methylbutanamide |
|---|---|
| PubChem CID | 115734359 |
| Molecular Formula | C8H15ClN2O |
| Molecular Weight | 190.67 g/mol |
| Exact Mass | 190.09 |
| IUPAC Name | 2-amino-N-(2-chloroprop-2-enyl)-3-methylbutanamide |
| SMILES | C=C(Cl)CNC(=O)C(N)C(C)C |
| InChI | InChI=1S/C8H15ClN2O/c1-5(2)7(10)8(12)11-4-6(3)9/h5,7H,3-4,10H2,1-2H3,(H,11,12) |
| InChIKey | JUHPGEYDJGDZRA-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.67 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |