C9H18N4O3 — CID 174452502
2-amino-N-(3,4-diamino-2,4-dioxobutyl)-3-methylbutanamide (PubChem CID 174452502) has the molecular formula C9H18N4O3 and a molecular weight of 230.27 g/mol. Its IUPAC name is 2-amino-N-(3,4-diamino-2,4-dioxobutyl)-3-methylbutanamide.
| Compound Name | 2-amino-N-(3,4-diamino-2,4-dioxobutyl)-3-methylbutanamide |
|---|---|
| PubChem CID | 174452502 |
| Molecular Formula | C9H18N4O3 |
| Molecular Weight | 230.27 g/mol |
| Exact Mass | 230.14 |
| IUPAC Name | 2-amino-N-(3,4-diamino-2,4-dioxobutyl)-3-methylbutanamide |
| SMILES | CC(C)C(N)C(=O)NCC(=O)C(N)C(N)=O |
| InChI | InChI=1S/C9H18N4O3/c1-4(2)6(10)9(16)13-3-5(14)7(11)8(12)15/h4,6-7H,3,10-11H2,1-2H3,(H2,12,15)(H,13,16) |
| InChIKey | YAEKPMGZFOMQMY-UHFFFAOYSA-N |
| XLogP | -2.53 |
| TPSA | 141.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.27 |
| LogP ≤ 5 | -2.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|