C16H19N3O — CID 115743893
4,4-dimethyl-5-[3-(1,3-oxazol-5-yl)anilino]pentanenitrile (PubChem CID 115743893) has the molecular formula C16H19N3O and a molecular weight of 269.35 g/mol. Its IUPAC name is 4,4-dimethyl-5-[3-(1,3-oxazol-5-yl)anilino]pentanenitrile.
| Compound Name | 4,4-dimethyl-5-[3-(1,3-oxazol-5-yl)anilino]pentanenitrile |
|---|---|
| PubChem CID | 115743893 |
| Molecular Formula | C16H19N3O |
| Molecular Weight | 269.35 g/mol |
| Exact Mass | 269.15 |
| IUPAC Name | 4,4-dimethyl-5-[3-(1,3-oxazol-5-yl)anilino]pentanenitrile |
| SMILES | CC(C)(CCC#N)CNc1cccc(-c2cnco2)c1 |
| InChI | InChI=1S/C16H19N3O/c1-16(2,7-4-8-17)11-19-14-6-3-5-13(9-14)15-10-18-12-20-15/h3,5-6,9-10,12,19H,4,7,11H2,1-2H3 |
| InChIKey | KGGRNYQUGJGNBJ-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 61.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.35 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |