C16H21N3O3 — CID 103818671
tert-butyl N-[2-[3-(1,3-oxazol-5-yl)anilino]ethyl]carbamate (PubChem CID 103818671) has the molecular formula C16H21N3O3 and a molecular weight of 303.36 g/mol. Its IUPAC name is tert-butyl N-[2-[3-(1,3-oxazol-5-yl)anilino]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[3-(1,3-oxazol-5-yl)anilino]ethyl]carbamate |
|---|---|
| PubChem CID | 103818671 |
| Molecular Formula | C16H21N3O3 |
| Molecular Weight | 303.36 g/mol |
| Exact Mass | 303.16 |
| IUPAC Name | tert-butyl N-[2-[3-(1,3-oxazol-5-yl)anilino]ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCNc1cccc(-c2cnco2)c1 |
| InChI | InChI=1S/C16H21N3O3/c1-16(2,3)22-15(20)19-8-7-18-13-6-4-5-12(9-13)14-10-17-11-21-14/h4-6,9-11,18H,7-8H2,1-3H3,(H,19,20) |
| InChIKey | IEXHHALMPZLHRO-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 76.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.36 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|